BDBM667852 US11958871, Example 17
SMILES NC(=N)NCCOc1ccc(CNc2cnc3[nH]cnc3c2)cc1
InChI Key InChIKey=XYKDGUBKTDUPNI-UHFFFAOYSA-N
Data 4 KI
Activity Spreadsheet -- Enzyme Inhibition Constant Data from BindingDB
Found 4 hits for monomerid = 667852
TargetGlutamine cyclotransferase-related protein(Porphyromonas gingivalis)
Fraunhofer-Gesellschaft Zur Forderung Der Angewandten Forschung
US Patent
Fraunhofer-Gesellschaft Zur Forderung Der Angewandten Forschung
US Patent
Affinity DataKi: 14nMAssay Description:For inhibitor testing, the sample composition was the same as described above, except for the addition of the putative inhibitory compound. This resu...More data for this Ligand-Target Pair
TargetPeptidase, M28 family(Bacteroides forsythus)
Fraunhofer-Gesellschaft Zur Forderung Der Angewandten Forschung
US Patent
Fraunhofer-Gesellschaft Zur Forderung Der Angewandten Forschung
US Patent
TargetPeptidase M28 domain-containing protein(Prevotella Intermedia)
Fraunhofer-Gesellschaft Zur Forderung Der Angewandten Forschung
US Patent
Fraunhofer-Gesellschaft Zur Forderung Der Angewandten Forschung
US Patent
TargetGlutaminyl-peptide cyclotransferase(Human)
Fraunhofer-Gesellschaft Zur Forderung Der Angewandten Forschung
US Patent
Fraunhofer-Gesellschaft Zur Forderung Der Angewandten Forschung
US Patent