BDBM640885 US20230399327, Example 103::US20230399327, Example 99
SMILES COc1nc2CCN(C)Cc2cc1Nc1ncc2ccnc(N[C@@H]3CCC[C@H]3O)c2n1
InChI Key InChIKey=UWBUZQOMODMARP-UHFFFAOYSA-N
Data 2 IC50
Activity Spreadsheet -- Enzyme Inhibition Constant Data from BindingDB
Found 2 hits for monomerid = 640885
TargetMitogen-activated protein kinase kinase kinase kinase 1(Human)
Adlai Nortye Biopharma Co.
US Patent
Adlai Nortye Biopharma Co.
US Patent
Affinity DataIC50: 0.100nMAssay Description:The specific operation is as follows: configure the enzymatic reaction system buffer (10 mM MOPS, pH 7.2, 5 mM β-glycerol-phosphate, 10 mM MgCl2...More data for this Ligand-Target Pair
TargetMitogen-activated protein kinase kinase kinase kinase 1(Human)
Adlai Nortye Biopharma Co.
US Patent
Adlai Nortye Biopharma Co.
US Patent
Affinity DataIC50: 0.100nMAssay Description:The specific operation is as follows: configure the enzymatic reaction system buffer (10 mM MOPS, pH 7.2, 5 mM β-glycerol-phosphate, 10 mM MgCl2...More data for this Ligand-Target Pair
