BDBM557694 US11358971, Compound 1c::US11466027, Compound 1e
SMILES Cc1ccnc2c1sc(c2)C(=O)NC[C@H](C(=O)O)N
InChI Key InChIKey=QRAZNSMFVGTRFM-UHFFFAOYSA-N
Data 2 KI
Activity Spreadsheet -- Enzyme Inhibition Constant Data from BindingDB
Found 2 hits for monomerid = 557694
Affinity DataKi: 96nMAssay Description:To determine the affinity of the compounds of the present invention a SPA is used. The assay is run in a 384-plate format (OptiPlate-384) where each ...More data for this Ligand-Target Pair
Affinity DataKi: 96nMAssay Description:To determine the affinity of the compounds of the present invention a SPA is used. The assay is run in a 384-plate format (OptiPlate-384) where each ...More data for this Ligand-Target Pair
