BDBM557267 US11352354, Example V-c-19
SMILES Cc1ccc(NC(=O)c2cccc(c2)C(F)(F)F)cc1Nc1nc(-c2cccnc2)c2[nH]ccc2n1
InChI Key InChIKey=OWCWJPJSIPHEQG-UHFFFAOYSA-N
Data 2 Kd
Activity Spreadsheet -- Enzyme Inhibition Constant Data from BindingDB
Found 2 hits for monomerid = 557267
Affinity DataKd: 1.50E+4nMAssay Description:1. Preparation of magnetic beads: biotin-labeled small molecule ligand and avidin-coated magnetic beads were allowed to interact at room temperature ...More data for this Ligand-Target Pair
Affinity DataKd: 1.60E+4nMAssay Description:1. Preparation of magnetic beads: biotin-labeled small molecule ligand and avidin-coated magnetic beads were allowed to interact at room temperature ...More data for this Ligand-Target Pair
