BDBM50280654 (S)-5-Guanidino-2-{[(S)-1-((S)-2-methylamino-2-phenyl-acetyl)-pyrrolidine-2-carbonyl]-amino}-pentanoic acid::CHEMBL8108
SMILES CN[C@H](C(=O)N1CCC[C@H]1C(=O)N[C@@H](CCCNC(N)=N)C(O)=O)c1ccccc1
InChI Key InChIKey=CJUOBXSVMSLLKV-UHFFFAOYSA-N
Data 5 IC50
Activity Spreadsheet -- Enzyme Inhibition Constant Data from BindingDB
Found 5 hits for monomerid = 50280654
Affinity DataIC50: 20nMAssay Description:In vitro concentration of compound required to inhibit 50% of trypsinMore data for this Ligand-Target Pair
Affinity DataIC50: 20nMAssay Description:In vitro concentration of compound required to inhibit 50% of 6 nM thrombinMore data for this Ligand-Target Pair
Affinity DataIC50: 500nMAssay Description:In vitro concentration of compound required to inhibit 50% of plasminMore data for this Ligand-Target Pair
Affinity DataIC50: 1.20E+4nMAssay Description:In vitro concentration of compound required to inhibit 50% of kallikreinMore data for this Ligand-Target Pair
Affinity DataIC50: 2.20E+3nMAssay Description:In vitro concentration of compound required to inhibit 50% of Factor XaMore data for this Ligand-Target Pair