BDBM336322 (S)-1-(7-chloro-5-(5- (1,1,1,-trifluoro-2- hydroxypropan-2- yl)pydine-3- yl)indolin-1- yl)ethanone::US9745282, 4::US9745282, 5
SMILES CC(=O)N1CCc2cc(cc(Cl)c12)-c1cncc(c1)C(C)(O)C(F)(F)F
InChI Key InChIKey=VFPNOGKANXUTFD-UHFFFAOYSA-N
Data 4 IC50
Activity Spreadsheet -- Enzyme Inhibition Constant Data from BindingDB
Found 4 hits for monomerid = 336322
Affinity DataIC50: 1.20nMAssay Description:V79 cell lines stably expressing the either the human CYP11B2 or the human CYP11B1 enzyme were generated using a standard transfection protocol. V79 ...More data for this Ligand-Target Pair
Affinity DataIC50: 2.40nMAssay Description:V79 cell lines stably expressing the either the human CYP11B2 or the human CYP11B1 enzyme were generated using a standard transfection protocol. V79 ...More data for this Ligand-Target Pair
