BDBM19238 2-{2-chloro-5-[4-({[(2,4-difluorophenyl)methyl](3-methanesulfonamido-2-methylphenyl)amino}methyl)phenoxy]phenoxy}acetic acid::GR sulfonamide modulator, 15
SMILES Cc1c(NS(C)(=O)=O)cccc1N(Cc1ccc(Oc2ccc(Cl)c(OCC(O)=O)c2)cc1)Cc1ccc(F)cc1F
InChI Key InChIKey=USLSTEHVCOVPEK-UHFFFAOYSA-N
Activity Spreadsheet -- Enzyme Inhibition Constant Data from BindingDB
Found 5 hits for monomerid = 19238
Affinity DataIC50: 2.60nM EC50: 500nMpH: 8.0 T: 2°CAssay Description:For compounds able to displace the 3(H)-dexamethasone from the receptor an IC50 value (the concentration required to inhibit 50% of the binding of 3(...More data for this Ligand-Target Pair
Affinity DataIC50: 1.90nMpH: 8.0 T: 2°CAssay Description:For compounds able to displace the radiolabeled ligand (competitor) from the receptor an IC50 value (the concentration required to inhibit 50% of the...More data for this Ligand-Target Pair
Affinity DataIC50: 150nMpH: 8.0 T: 2°CAssay Description:For compounds able to displace the radiolabeled ligand (competitor) from the receptor an IC50 value (the concentration required to inhibit 50% of the...More data for this Ligand-Target Pair
Affinity DataIC50: 3.60E+3nMpH: 8.0 T: 2°CAssay Description:For compounds able to displace the radiolabeled ligand (competitor) from the receptor an IC50 value (the concentration required to inhibit 50% of the...More data for this Ligand-Target Pair
Affinity DataIC50: 1.00E+3nMpH: 8.0 T: 2°CAssay Description:For compounds able to displace the radiolabeled ligand (competitor) from the receptor an IC50 value (the concentration required to inhibit 50% of the...More data for this Ligand-Target Pair