BDBM19233 (2R,10S,11S,14S,15S)-14-hydroxy-15-methyl-2-[(4-methylphenyl)methyl]-14-(prop-1-yn-1-yl)tetracyclo[8.7.0.0^{2,7}.0^{11,15}]heptadeca-1(17),6-dien-5-one::steroid antagonist, 2
SMILES [H][C@@]12CC[C@@](O)(C#CC)[C@@]1(C)CC=C1[C@@]2([H])CCC2=CC(=O)CC[C@]12Cc1ccc(C)cc1
InChI Key InChIKey=NSUUUQRFPXZFLI-UHFFFAOYSA-N
Activity Spreadsheet -- Enzyme Inhibition Constant Data from BindingDB
Found 5 hits for monomerid = 19233
Affinity DataIC50: 2.40nM EC50: 43nMpH: 8.0 T: 2°CAssay Description:For compounds able to displace the 3(H)-dexamethasone from the receptor an IC50 value (the concentration required to inhibit 50% of the binding of 3(...More data for this Ligand-Target Pair
Affinity DataIC50: 2.40nMpH: 8.0 T: 2°CAssay Description:For compounds able to displace the radiolabeled ligand (competitor) from the receptor an IC50 value (the concentration required to inhibit 50% of the...More data for this Ligand-Target Pair
Affinity DataIC50: 2.40E+3nMpH: 8.0 T: 2°CAssay Description:For compounds able to displace the radiolabeled ligand (competitor) from the receptor an IC50 value (the concentration required to inhibit 50% of the...More data for this Ligand-Target Pair
Affinity DataIC50: 6.50E+3nMpH: 8.0 T: 2°CAssay Description:For compounds able to displace the radiolabeled ligand (competitor) from the receptor an IC50 value (the concentration required to inhibit 50% of the...More data for this Ligand-Target Pair
Affinity DataIC50: 6.30E+3nMpH: 8.0 T: 2°CAssay Description:For compounds able to displace the radiolabeled ligand (competitor) from the receptor an IC50 value (the concentration required to inhibit 50% of the...More data for this Ligand-Target Pair