BDBM18900 2-[3,5-dibromo-4-(pentyloxy)phenyl]acetic acid::3,5-Dibromo-4-alkoxyphenylalkanoic Acid, 9c
SMILES CCCCCOc1c(Br)cc(CC(O)=O)cc1Br
InChI Key InChIKey=DMILDBSUKKQQDG-UHFFFAOYSA-N
Data 5 IC50
Activity Spreadsheet -- Enzyme Inhibition Constant Data from BindingDB
Found 5 hits for monomerid = 18900
Affinity DataIC50: 2.00E+4nMpH: 7.0 T: 2°CAssay Description:IIC50 is the concentration of each compound required to inhibit 50% binding of 125I-T3 to hTRalpha. EC50 is the concentration of compound required to...More data for this Ligand-Target Pair
Affinity DataIC50: 5.70E+3nMpH: 7.0 T: 2°CAssay Description:IC50 is the concentration of each compound required to inhibit 50% binding of 125I-T3 to hTRbeta. EC50 is the concentration of compound required to i...More data for this Ligand-Target Pair
Affinity DataIC50: 5.75E+3nMAssay Description:Inhibition of human thyroid hormone receptor beta 1More data for this Ligand-Target Pair
Affinity DataIC50: 5.75E+3nMAssay Description:Inhibition of thyroid hormone receptor betaMore data for this Ligand-Target Pair
Affinity DataIC50: 2.00E+4nMAssay Description:Inhibition of thyroid hormone receptor alphaMore data for this Ligand-Target Pair