BDBM18898 2-(3,5-dibromo-4-ethoxyphenyl)acetic acid::3,5-Dibromo-4-alkoxyphenylalkanoic Acid, 9a
SMILES CCOc1c(Br)cc(CC(O)=O)cc1Br
InChI Key InChIKey=WXHBNMDFFFIDJQ-UHFFFAOYSA-N
Data 3 IC50
Activity Spreadsheet -- Enzyme Inhibition Constant Data from BindingDB
Found 3 hits for monomerid = 18898
Affinity DataIC50: 1.60E+5nMpH: 7.0 T: 2°CAssay Description:IIC50 is the concentration of each compound required to inhibit 50% binding of 125I-T3 to hTRalpha. EC50 is the concentration of compound required to...More data for this Ligand-Target Pair
Affinity DataIC50: 3.20E+4nMpH: 7.0 T: 2°CAssay Description:IC50 is the concentration of each compound required to inhibit 50% binding of 125I-T3 to hTRbeta. EC50 is the concentration of compound required to i...More data for this Ligand-Target Pair
Affinity DataIC50: 3.24E+4nMAssay Description:Inhibition of human thyroid hormone receptor beta 1More data for this Ligand-Target Pair