BDBM18868 3,5-dichloro-4-[4-hydroxy-3-(propan-2-yl)phenoxy]benzoic acid::dichloro benzoic acid, 11b
SMILES CC(C)c1cc(Oc2c(Cl)cc(cc2Cl)C(O)=O)ccc1O
InChI Key InChIKey=TVQYCFFCYRSFQF-UHFFFAOYSA-N
Activity Spreadsheet -- Enzyme Inhibition Constant Data from BindingDB
Found 5 hits for monomerid = 18868
Affinity DataIC50: 130nM EC50: 190nMpH: 7.0 T: 2°CAssay Description:IC50 is the concentration of each compound required to inhibit 50% binding of 125I-T3 to hTRalpha. EC50 is the concentration of compound required to ...More data for this Ligand-Target Pair
Affinity DataIC50: 21nM EC50: 150nMpH: 7.0 T: 2°CAssay Description:IC50 is the concentration of each compound required to inhibit 50% binding of 125I-T3 to hTRbeta. EC50 is the concentration of compound required to r...More data for this Ligand-Target Pair
Affinity DataIC50: 20.9nMAssay Description:Inhibition of human thyroid hormone receptor beta 1More data for this Ligand-Target Pair
Affinity DataIC50: 129nMAssay Description:Inhibition of thyroid hormone receptor alphaMore data for this Ligand-Target Pair
Affinity DataIC50: 20.9nMAssay Description:Inhibition of thyroid hormone receptor betaMore data for this Ligand-Target Pair
