BDBM18867 2-{3,5-dibromo-4-[4-hydroxy-3-(propan-2-yl)phenoxy]phenyl}acetic acid::KB-131092::dibromo phenylacetic acid, 11a
SMILES CC(C)c1cc(Oc2c(Br)cc(CC(O)=O)cc2Br)ccc1O
InChI Key InChIKey=FDLOBNTWQDSHPF-UHFFFAOYSA-N
Activity Spreadsheet -- Enzyme Inhibition Constant Data from BindingDB
Found 9 hits for monomerid = 18867
Affinity DataIC50: 1.40nM EC50: 0.380nMpH: 7.0 T: 2°CAssay Description:IC50 is the concentration of each compound required to inhibit 50% binding of 125I-T3 to hTRalpha. EC50 is the concentration of compound required to ...More data for this Ligand-Target Pair
Affinity DataIC50: 0.0950nM EC50: 0.200nMpH: 7.0 T: 2°CAssay Description:IC50 is the concentration of each compound required to inhibit 50% binding of 125I-T3 to hTRbeta. EC50 is the concentration of compound required to r...More data for this Ligand-Target Pair
Affinity DataIC50: 1.40nM EC50: 0.380nMpH: 7.0 T: 2°CAssay Description:IC50 is the concentration of each compound required to inhibit 50% binding of 125I-T3 to hTRalpha. EC50 is the concentration of compound required to ...More data for this Ligand-Target Pair
Affinity DataIC50: 0.0950nM EC50: 0.200nMpH: 7.0 T: 2°CAssay Description:IC50 is the concentration of each compound required to inhibit 50% binding of 125I-T3 to hTRbeta. EC50 is the concentration of compound required to r...More data for this Ligand-Target Pair
Affinity DataIC50: 1.40nMpH: 7.0 T: 2°CAssay Description:IC50 is the concentration of each compound required to inhibit 50% binding of 125I-T3 to hTRalpha. More data for this Ligand-Target Pair
Affinity DataIC50: 0.100nMAssay Description:IC50 is the concentration of each compound required to inhibit 50% binding of 125I-T3 to hTRalpha. More data for this Ligand-Target Pair
Affinity DataIC50: 0.0955nMAssay Description:Inhibition of human thyroid hormone receptor beta 1More data for this Ligand-Target Pair
Affinity DataIC50: 1.55nMAssay Description:Inhibition of thyroid hormone receptor alphaMore data for this Ligand-Target Pair
Affinity DataIC50: 0.0955nMAssay Description:Inhibition of thyroid hormone receptor betaMore data for this Ligand-Target Pair
