BDBM159311 US10093663, Example 16::US9682968, Example-16
SMILES Cc1cc(C2CC2)c(CN2CCCC[C@H]2c2ccc(C(O)=O)c(F)c2)c2cc[nH]c12
InChI Key InChIKey=OUDHJLAYNXAKSM-UHFFFAOYSA-N
Data 2 IC50
Activity Spreadsheet -- Enzyme Inhibition Constant Data from BindingDB
Found 2 hits for monomerid = 159311
Affinity DataIC50: 0.0300nMAssay Description:CVF-Bb complex prepared from purified cobra venom factor (1 uM), recombinant human complement factor B (expressed in drosophila cells and purified us...More data for this Ligand-Target Pair
Affinity DataIC50: 30nMpH: 7.4 T: 2°CAssay Description:CVF-Bb complex prepared from purified cobra venom factor (1 μM), recombinant human complement factor B (expressed in drosophila cells and purifi...More data for this Ligand-Target Pair
